C21H24Cl2N4O5 — CID 12043816
2-chloroethyl 5-[2-[4-(2-chloroethoxycarbonylamino)phenyl]propanoylamino]-3-cyclopropylpyrazole-1-carboxylate (PubChem CID 12043816) has the molecular formula C21H24Cl2N4O5 and a molecular weight of 483.35 g/mol. Its IUPAC name is 2-chloroethyl 5-[2-[4-(2-chloroethoxycarbonylamino)phenyl]propanoylamino]-3-cyclopropylpyrazole-1-carboxylate.
| Compound Name | 2-chloroethyl 5-[2-[4-(2-chloroethoxycarbonylamino)phenyl]propanoylamino]-3-cyclopropylpyrazole-1-carboxylate |
|---|---|
| PubChem CID | 12043816 |
| Molecular Formula | C21H24Cl2N4O5 |
| Molecular Weight | 483.35 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 2-chloroethyl 5-[2-[4-(2-chloroethoxycarbonylamino)phenyl]propanoylamino]-3-cyclopropylpyrazole-1-carboxylate |
| SMILES | CC(C(=O)Nc1cc(C2CC2)nn1C(=O)OCCCl)c1ccc(NC(=O)OCCCl)cc1 |
| InChI | InChI=1S/C21H24Cl2N4O5/c1-13(14-4-6-16(7-5-14)24-20(29)31-10-8-22)19(28)25-18-12-17(15-2-3-15)26-27(18)21(30)32-11-9-23/h4-7,12-13,15H,2-3,8-11H2,1H3,(H,24,29)(H,25,28) |
| InChIKey | RQULQHRJOHPRHZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|