About (4-methylphenyl) N-butanoylsulfamate
(4-methylphenyl) N-butanoylsulfamate (PubChem CID 12045636) has the molecular formula C11H15NO4S
and a molecular weight of 257.31 g/mol. Its IUPAC name is (4-methylphenyl) N-butanoylsulfamate.
Molecular Properties
| Compound Name | (4-methylphenyl) N-butanoylsulfamate |
| PubChem CID | 12045636 |
| Molecular Formula | C11H15NO4S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | (4-methylphenyl) N-butanoylsulfamate |
| SMILES | CCCC(=O)NS(=O)(=O)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C11H15NO4S/c1-3-4-11(13)12-17(14,15)16-10-7-5-9(2)6-8-10/h5-8H,3-4H2,1-2H3,(H,12,13) |
| InChIKey | ALVKICLIBDXNGY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-methylphenyl) N-butanoylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl) N-butanoylsulfamate?
The IUPAC name of (4-methylphenyl) N-butanoylsulfamate (CID 12045636) is (4-methylphenyl) N-butanoylsulfamate.
What is the SMILES notation for (4-methylphenyl) N-butanoylsulfamate?
The canonical SMILES for (4-methylphenyl) N-butanoylsulfamate is CCCC(=O)NS(=O)(=O)Oc1ccc(C)cc1.
What is the InChIKey of (4-methylphenyl) N-butanoylsulfamate?
The InChIKey is ALVKICLIBDXNGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO4S/c1-3-4-11(13)12-17(14,15)16-10-7-5-9(2)6-8-10/h5-8H,3-4H2,1-2H3,(H,12,13).
What are the key properties of (4-methylphenyl) N-butanoylsulfamate?
(4-methylphenyl) N-butanoylsulfamate has a molecular weight of 257.31 g/mol, XLogP of 1.53, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl) N-butanoylsulfamate is sourced from PubChem (CID 12045636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).