C19H20O3 — CID 12046892
(2S)-3-(1-benzofuran-2-yl)-5-phenylpentane-2,3-diol (PubChem CID 12046892) has the molecular formula C19H20O3 and a molecular weight of 296.37 g/mol. Its IUPAC name is (2S)-3-(1-benzofuran-2-yl)-5-phenylpentane-2,3-diol.
| Compound Name | (2S)-3-(1-benzofuran-2-yl)-5-phenylpentane-2,3-diol |
|---|---|
| PubChem CID | 12046892 |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | (2S)-3-(1-benzofuran-2-yl)-5-phenylpentane-2,3-diol |
| SMILES | C[C@H](O)C(O)(CCc1ccccc1)c1cc2ccccc2o1 |
| InChI | InChI=1S/C19H20O3/c1-14(20)19(21,12-11-15-7-3-2-4-8-15)18-13-16-9-5-6-10-17(16)22-18/h2-10,13-14,20-21H,11-12H2,1H3/t14-,19?/m0/s1 |
| InChIKey | VUMQNJNMGYTSHP-KTQQKIMGSA-N |
| XLogP | 3.63 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |