C15H26ClN3O4S — CID 120500865
3-amino-N-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methylbutanamide;hydrochloride (PubChem CID 120500865) has the molecular formula C15H26ClN3O4S and a molecular weight of 379.91 g/mol. Its IUPAC name is 3-amino-N-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methylbutanamide;hydrochloride.
| Compound Name | 3-amino-N-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 120500865 |
| Molecular Formula | C15H26ClN3O4S |
| Molecular Weight | 379.91 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | 3-amino-N-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methylbutanamide;hydrochloride |
| SMILES | COCCNS(=O)(=O)c1cccc(CNC(=O)C(C)C(C)N)c1.Cl |
| InChI | InChI=1S/C15H25N3O4S.ClH/c1-11(12(2)16)15(19)17-10-13-5-4-6-14(9-13)23(20,21)18-7-8-22-3;/h4-6,9,11-12,18H,7-8,10,16H2,1-3H3,(H,17,19);1H |
| InChIKey | PJLFSYUCKHIBEY-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.91 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|