C22H29N3O5S — CID 55749562
N-butan-2-yl-3-[[[3-(2-methoxyethylsulfamoyl)benzoyl]amino]methyl]benzamide (PubChem CID 55749562) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-butan-2-yl-3-[[[3-(2-methoxyethylsulfamoyl)benzoyl]amino]methyl]benzamide.
| Compound Name | N-butan-2-yl-3-[[[3-(2-methoxyethylsulfamoyl)benzoyl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 55749562 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-butan-2-yl-3-[[[3-(2-methoxyethylsulfamoyl)benzoyl]amino]methyl]benzamide |
| SMILES | CCC(C)NC(=O)c1cccc(CNC(=O)c2cccc(S(=O)(=O)NCCOC)c2)c1 |
| InChI | InChI=1S/C22H29N3O5S/c1-4-16(2)25-22(27)18-8-5-7-17(13-18)15-23-21(26)19-9-6-10-20(14-19)31(28,29)24-11-12-30-3/h5-10,13-14,16,24H,4,11-12,15H2,1-3H3,(H,23,26)(H,25,27) |
| InChIKey | QNGPOGNNNJFJDZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|