C19H25N3O4S — CID 120610760
3-(2-aminophenyl)-N-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]propanamide (PubChem CID 120610760) has the molecular formula C19H25N3O4S and a molecular weight of 391.49 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]propanamide.
| Compound Name | 3-(2-aminophenyl)-N-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 120610760 |
| Molecular Formula | C19H25N3O4S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 3-(2-aminophenyl)-N-[[3-(2-methoxyethylsulfamoyl)phenyl]methyl]propanamide |
| SMILES | COCCNS(=O)(=O)c1cccc(CNC(=O)CCc2ccccc2N)c1 |
| InChI | InChI=1S/C19H25N3O4S/c1-26-12-11-22-27(24,25)17-7-4-5-15(13-17)14-21-19(23)10-9-16-6-2-3-8-18(16)20/h2-8,13,22H,9-12,14,20H2,1H3,(H,21,23) |
| InChIKey | OHCBQHIHUOIJKR-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|