C19H26N2O4 — CID 12050236
3-pyridin-3-ylpropyl (2S)-1-(4-methyl-2-oxopentanoyl)pyrrolidine-2-carboxylate (PubChem CID 12050236) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl (2S)-1-(4-methyl-2-oxopentanoyl)pyrrolidine-2-carboxylate.
| Compound Name | 3-pyridin-3-ylpropyl (2S)-1-(4-methyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 12050236 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3-pyridin-3-ylpropyl (2S)-1-(4-methyl-2-oxopentanoyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)CC(=O)C(=O)N1CCC[C@H]1C(=O)OCCCc1cccnc1 |
| InChI | InChI=1S/C19H26N2O4/c1-14(2)12-17(22)18(23)21-10-4-8-16(21)19(24)25-11-5-7-15-6-3-9-20-13-15/h3,6,9,13-14,16H,4-5,7-8,10-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | FSFOZWCLUWCAGS-INIZCTEOSA-N |
| XLogP | 2.16 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|