C16H26Cl2N4O — CID 120503091
3-amino-N-(2-butyl-3H-benzimidazol-5-yl)-2-methylbutanamide;dihydrochloride (PubChem CID 120503091) has the molecular formula C16H26Cl2N4O and a molecular weight of 361.32 g/mol. Its IUPAC name is 3-amino-N-(2-butyl-3H-benzimidazol-5-yl)-2-methylbutanamide;dihydrochloride.
| Compound Name | 3-amino-N-(2-butyl-3H-benzimidazol-5-yl)-2-methylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 120503091 |
| Molecular Formula | C16H26Cl2N4O |
| Molecular Weight | 361.32 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-amino-N-(2-butyl-3H-benzimidazol-5-yl)-2-methylbutanamide;dihydrochloride |
| SMILES | CCCCc1nc2ccc(NC(=O)C(C)C(C)N)cc2[nH]1.Cl.Cl |
| InChI | InChI=1S/C16H24N4O.2ClH/c1-4-5-6-15-19-13-8-7-12(9-14(13)20-15)18-16(21)10(2)11(3)17;;/h7-11H,4-6,17H2,1-3H3,(H,18,21)(H,19,20);2*1H |
| InChIKey | NEXLQULBMKQQRM-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.32 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |