C20H23Cl2NO3 — CID 120511738
(2S)-2-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylamino]hexanoic acid (PubChem CID 120511738) has the molecular formula C20H23Cl2NO3 and a molecular weight of 396.31 g/mol. Its IUPAC name is (2S)-2-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylamino]hexanoic acid.
| Compound Name | (2S)-2-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylamino]hexanoic acid |
|---|---|
| PubChem CID | 120511738 |
| Molecular Formula | C20H23Cl2NO3 |
| Molecular Weight | 396.31 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | (2S)-2-[[4-[(3,4-dichlorophenyl)methoxy]phenyl]methylamino]hexanoic acid |
| SMILES | CCCC[C@H](NCc1ccc(OCc2ccc(Cl)c(Cl)c2)cc1)C(=O)O |
| InChI | InChI=1S/C20H23Cl2NO3/c1-2-3-4-19(20(24)25)23-12-14-5-8-16(9-6-14)26-13-15-7-10-17(21)18(22)11-15/h5-11,19,23H,2-4,12-13H2,1H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | VHNLRRKLIFPMHG-IBGZPJMESA-N |
| XLogP | 5.31 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.31 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |