C15H21Cl2NO3 — CID 122044613
(2S)-2-[1-(3,4-dichlorophenoxy)propan-2-ylamino]hexanoic acid (PubChem CID 122044613) has the molecular formula C15H21Cl2NO3 and a molecular weight of 334.24 g/mol. Its IUPAC name is (2S)-2-[1-(3,4-dichlorophenoxy)propan-2-ylamino]hexanoic acid.
| Compound Name | (2S)-2-[1-(3,4-dichlorophenoxy)propan-2-ylamino]hexanoic acid |
|---|---|
| PubChem CID | 122044613 |
| Molecular Formula | C15H21Cl2NO3 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (2S)-2-[1-(3,4-dichlorophenoxy)propan-2-ylamino]hexanoic acid |
| SMILES | CCCC[C@H](NC(C)COc1ccc(Cl)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C15H21Cl2NO3/c1-3-4-5-14(15(19)20)18-10(2)9-21-11-6-7-12(16)13(17)8-11/h6-8,10,14,18H,3-5,9H2,1-2H3,(H,19,20)/t10?,14-/m0/s1 |
| InChIKey | LNMUOSXRPHUCAH-SBNLOKMTSA-N |
| XLogP | 3.99 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |