C15H23N3O3S — CID 120520647
2-[4-[5-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]thiomorpholin-3-yl]acetic acid (PubChem CID 120520647) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-[4-[5-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]thiomorpholin-3-yl]acetic acid.
| Compound Name | 2-[4-[5-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]thiomorpholin-3-yl]acetic acid |
|---|---|
| PubChem CID | 120520647 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[4-[5-methyl-1-(2-methylpropyl)pyrazole-4-carbonyl]thiomorpholin-3-yl]acetic acid |
| SMILES | Cc1c(C(=O)N2CCSCC2CC(=O)O)cnn1CC(C)C |
| InChI | InChI=1S/C15H23N3O3S/c1-10(2)8-18-11(3)13(7-16-18)15(21)17-4-5-22-9-12(17)6-14(19)20/h7,10,12H,4-6,8-9H2,1-3H3,(H,19,20) |
| InChIKey | NSYGHPQKTLXQQT-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |