C17H21N3O5S — CID 120522002
2-[1-[[2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetyl]amino]cyclobutyl]acetic acid (PubChem CID 120522002) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-[1-[[2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetyl]amino]cyclobutyl]acetic acid.
| Compound Name | 2-[1-[[2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetyl]amino]cyclobutyl]acetic acid |
|---|---|
| PubChem CID | 120522002 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-[1-[[2-[2-(methylsulfonylmethyl)benzimidazol-1-yl]acetyl]amino]cyclobutyl]acetic acid |
| SMILES | CS(=O)(=O)Cc1nc2ccccc2n1CC(=O)NC1(CC(=O)O)CCC1 |
| InChI | InChI=1S/C17H21N3O5S/c1-26(24,25)11-14-18-12-5-2-3-6-13(12)20(14)10-15(21)19-17(7-4-8-17)9-16(22)23/h2-3,5-6H,4,7-11H2,1H3,(H,19,21)(H,22,23) |
| InChIKey | AFVWEKOVNQQVDL-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |