C15H22F3N3O3 — CID 120522589
6-[[2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]acetyl]amino]hexanoic acid (PubChem CID 120522589) has the molecular formula C15H22F3N3O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is 6-[[2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]acetyl]amino]hexanoic acid.
| Compound Name | 6-[[2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 120522589 |
| Molecular Formula | C15H22F3N3O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 6-[[2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]acetyl]amino]hexanoic acid |
| SMILES | Cc1nn(CC(F)(F)F)c(C)c1CC(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C15H22F3N3O3/c1-10-12(11(2)21(20-10)9-15(16,17)18)8-13(22)19-7-5-3-4-6-14(23)24/h3-9H2,1-2H3,(H,19,22)(H,23,24) |
| InChIKey | HIXJGTBHWHYWHA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|