C13H20F3N3O2 — CID 84594659
2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-N-[(2-methylpropan-2-yl)oxy]acetamide (PubChem CID 84594659) has the molecular formula C13H20F3N3O2 and a molecular weight of 307.32 g/mol. Its IUPAC name is 2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-N-[(2-methylpropan-2-yl)oxy]acetamide.
| Compound Name | 2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-N-[(2-methylpropan-2-yl)oxy]acetamide |
|---|---|
| PubChem CID | 84594659 |
| Molecular Formula | C13H20F3N3O2 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-[3,5-dimethyl-1-(2,2,2-trifluoroethyl)pyrazol-4-yl]-N-[(2-methylpropan-2-yl)oxy]acetamide |
| SMILES | Cc1nn(CC(F)(F)F)c(C)c1CC(=O)NOC(C)(C)C |
| InChI | InChI=1S/C13H20F3N3O2/c1-8-10(6-11(20)18-21-12(3,4)5)9(2)19(17-8)7-13(14,15)16/h6-7H2,1-5H3,(H,18,20) |
| InChIKey | HJSJTUOPJDXBEV-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|