C19H19F2NO3 — CID 120523745
4-[[3-(2,4-difluorophenyl)butanoyl-methylamino]methyl]benzoic acid (PubChem CID 120523745) has the molecular formula C19H19F2NO3 and a molecular weight of 347.36 g/mol. Its IUPAC name is 4-[[3-(2,4-difluorophenyl)butanoyl-methylamino]methyl]benzoic acid.
| Compound Name | 4-[[3-(2,4-difluorophenyl)butanoyl-methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 120523745 |
| Molecular Formula | C19H19F2NO3 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 4-[[3-(2,4-difluorophenyl)butanoyl-methylamino]methyl]benzoic acid |
| SMILES | CC(CC(=O)N(C)Cc1ccc(C(=O)O)cc1)c1ccc(F)cc1F |
| InChI | InChI=1S/C19H19F2NO3/c1-12(16-8-7-15(20)10-17(16)21)9-18(23)22(2)11-13-3-5-14(6-4-13)19(24)25/h3-8,10,12H,9,11H2,1-2H3,(H,24,25) |
| InChIKey | MDCVTAVNBMIDRV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |