C18H22FN3O3 — CID 120524082
7-[[1-(4-fluoro-2-methylphenyl)pyrazole-3-carbonyl]amino]heptanoic acid (PubChem CID 120524082) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is 7-[[1-(4-fluoro-2-methylphenyl)pyrazole-3-carbonyl]amino]heptanoic acid.
| Compound Name | 7-[[1-(4-fluoro-2-methylphenyl)pyrazole-3-carbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 120524082 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 7-[[1-(4-fluoro-2-methylphenyl)pyrazole-3-carbonyl]amino]heptanoic acid |
| SMILES | Cc1cc(F)ccc1-n1ccc(C(=O)NCCCCCCC(=O)O)n1 |
| InChI | InChI=1S/C18H22FN3O3/c1-13-12-14(19)7-8-16(13)22-11-9-15(21-22)18(25)20-10-5-3-2-4-6-17(23)24/h7-9,11-12H,2-6,10H2,1H3,(H,20,25)(H,23,24) |
| InChIKey | BUJUYNFTZBOCMW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|