C16H17Cl2N3O3 — CID 119220055
6-[[1-(3,4-dichlorophenyl)pyrazole-3-carbonyl]amino]hexanoic acid (PubChem CID 119220055) has the molecular formula C16H17Cl2N3O3 and a molecular weight of 370.24 g/mol. Its IUPAC name is 6-[[1-(3,4-dichlorophenyl)pyrazole-3-carbonyl]amino]hexanoic acid.
| Compound Name | 6-[[1-(3,4-dichlorophenyl)pyrazole-3-carbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 119220055 |
| Molecular Formula | C16H17Cl2N3O3 |
| Molecular Weight | 370.24 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 6-[[1-(3,4-dichlorophenyl)pyrazole-3-carbonyl]amino]hexanoic acid |
| SMILES | O=C(O)CCCCCNC(=O)c1ccn(-c2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C16H17Cl2N3O3/c17-12-6-5-11(10-13(12)18)21-9-7-14(20-21)16(24)19-8-3-1-2-4-15(22)23/h5-7,9-10H,1-4,8H2,(H,19,24)(H,22,23) |
| InChIKey | NAYCFFKZJZTFQR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.24 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|