C13H13F3N2O4 — CID 120527535
2-[4-[3-(trifluoromethyl)pyridine-2-carbonyl]morpholin-2-yl]acetic acid (PubChem CID 120527535) has the molecular formula C13H13F3N2O4 and a molecular weight of 318.25 g/mol. Its IUPAC name is 2-[4-[3-(trifluoromethyl)pyridine-2-carbonyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[3-(trifluoromethyl)pyridine-2-carbonyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 120527535 |
| Molecular Formula | C13H13F3N2O4 |
| Molecular Weight | 318.25 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[4-[3-(trifluoromethyl)pyridine-2-carbonyl]morpholin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CN(C(=O)c2ncccc2C(F)(F)F)CCO1 |
| InChI | InChI=1S/C13H13F3N2O4/c14-13(15,16)9-2-1-3-17-11(9)12(21)18-4-5-22-8(7-18)6-10(19)20/h1-3,8H,4-7H2,(H,19,20) |
| InChIKey | VKSRAXCUOVOTOW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.25 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |