C17H18F3NO4 — CID 126771960
2-[4-[3-[2-(trifluoromethyl)phenyl]but-2-enoyl]morpholin-2-yl]acetic acid (PubChem CID 126771960) has the molecular formula C17H18F3NO4 and a molecular weight of 357.33 g/mol. Its IUPAC name is 2-[4-[3-[2-(trifluoromethyl)phenyl]but-2-enoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[3-[2-(trifluoromethyl)phenyl]but-2-enoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 126771960 |
| Molecular Formula | C17H18F3NO4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-[4-[3-[2-(trifluoromethyl)phenyl]but-2-enoyl]morpholin-2-yl]acetic acid |
| SMILES | CC(=CC(=O)N1CCOC(CC(=O)O)C1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H18F3NO4/c1-11(13-4-2-3-5-14(13)17(18,19)20)8-15(22)21-6-7-25-12(10-21)9-16(23)24/h2-5,8,12H,6-7,9-10H2,1H3,(H,23,24) |
| InChIKey | SXSNEJGJITZUHH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|