C17H21F3N2O2 — CID 111487178
1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-[2-(trifluoromethyl)phenyl]but-2-en-1-one (PubChem CID 111487178) has the molecular formula C17H21F3N2O2 and a molecular weight of 342.36 g/mol. Its IUPAC name is 1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-[2-(trifluoromethyl)phenyl]but-2-en-1-one.
| Compound Name | 1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-[2-(trifluoromethyl)phenyl]but-2-en-1-one |
|---|---|
| PubChem CID | 111487178 |
| Molecular Formula | C17H21F3N2O2 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 1-[4-(2-hydroxyethyl)piperazin-1-yl]-3-[2-(trifluoromethyl)phenyl]but-2-en-1-one |
| SMILES | CC(=CC(=O)N1CCN(CCO)CC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C17H21F3N2O2/c1-13(14-4-2-3-5-15(14)17(18,19)20)12-16(24)22-8-6-21(7-9-22)10-11-23/h2-5,12,23H,6-11H2,1H3 |
| InChIKey | BPNVDJDQNQVMIB-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|