C22H23F3N2O2 — CID 59382207
1-[2-[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazine-1-carbonyl]phenyl]ethanone (PubChem CID 59382207) has the molecular formula C22H23F3N2O2 and a molecular weight of 404.43 g/mol. Its IUPAC name is 1-[2-[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazine-1-carbonyl]phenyl]ethanone.
| Compound Name | 1-[2-[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazine-1-carbonyl]phenyl]ethanone |
|---|---|
| PubChem CID | 59382207 |
| Molecular Formula | C22H23F3N2O2 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | 1-[2-[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazine-1-carbonyl]phenyl]ethanone |
| SMILES | CC(=O)c1ccccc1C(=O)N1CCN(CCc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H23F3N2O2/c1-16(28)18-7-3-4-8-19(18)21(29)27-14-12-26(13-15-27)11-10-17-6-2-5-9-20(17)22(23,24)25/h2-9H,10-15H2,1H3 |
| InChIKey | VFTDLLHGWOLMIR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |