C17H22F3N3O2 — CID 70416791
[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazin-1-yl] (Z)-3-aminobut-2-enoate (PubChem CID 70416791) has the molecular formula C17H22F3N3O2 and a molecular weight of 357.38 g/mol. Its IUPAC name is [4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazin-1-yl] (Z)-3-aminobut-2-enoate.
| Compound Name | [4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazin-1-yl] (Z)-3-aminobut-2-enoate |
|---|---|
| PubChem CID | 70416791 |
| Molecular Formula | C17H22F3N3O2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | [4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazin-1-yl] (Z)-3-aminobut-2-enoate |
| SMILES | C/C(N)=C/C(=O)ON1CCN(CCc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H22F3N3O2/c1-13(21)12-16(24)25-23-10-8-22(9-11-23)7-6-14-4-2-3-5-15(14)17(18,19)20/h2-5,12H,6-11,21H2,1H3/b13-12- |
| InChIKey | NCVOPQGPJARZKP-SEYXRHQNSA-N |
| XLogP | 2.19 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|