C23H23F3N2O5 — CID 19004491
2-oxo-2-[4-[2-oxo-2-[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazin-1-yl]ethoxy]phenyl]acetic acid (PubChem CID 19004491) has the molecular formula C23H23F3N2O5 and a molecular weight of 464.44 g/mol. Its IUPAC name is 2-oxo-2-[4-[2-oxo-2-[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazin-1-yl]ethoxy]phenyl]acetic acid.
| Compound Name | 2-oxo-2-[4-[2-oxo-2-[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazin-1-yl]ethoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 19004491 |
| Molecular Formula | C23H23F3N2O5 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-oxo-2-[4-[2-oxo-2-[4-[2-[2-(trifluoromethyl)phenyl]ethyl]piperazin-1-yl]ethoxy]phenyl]acetic acid |
| SMILES | O=C(O)C(=O)c1ccc(OCC(=O)N2CCN(CCc3ccccc3C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C23H23F3N2O5/c24-23(25,26)19-4-2-1-3-16(19)9-10-27-11-13-28(14-12-27)20(29)15-33-18-7-5-17(6-8-18)21(30)22(31)32/h1-8H,9-15H2,(H,31,32) |
| InChIKey | VWKIROBJKRGGSZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|