C23H23F3N2O3 — CID 155527529
(E)-1-[4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 155527529) has the molecular formula C23H23F3N2O3 and a molecular weight of 432.44 g/mol. Its IUPAC name is (E)-1-[4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 155527529 |
| Molecular Formula | C23H23F3N2O3 |
| Molecular Weight | 432.44 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (E)-1-[4-[2-(4-methylpiperazin-1-yl)-2-oxoethoxy]phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | CN1CCN(C(=O)COc2ccc(C(=O)/C=C/c3ccccc3C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C23H23F3N2O3/c1-27-12-14-28(15-13-27)22(30)16-31-19-9-6-18(7-10-19)21(29)11-8-17-4-2-3-5-20(17)23(24,25)26/h2-11H,12-16H2,1H3/b11-8+ |
| InChIKey | LEXYWKGISNTGKV-DHZHZOJOSA-N |
| XLogP | 3.75 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|