C23H25ClF3NO3 — CID 71812184
(E)-1-[4-(3-morpholin-4-ylpropoxy)phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one;hydrochloride (PubChem CID 71812184) has the molecular formula C23H25ClF3NO3 and a molecular weight of 455.90 g/mol. Its IUPAC name is (E)-1-[4-(3-morpholin-4-ylpropoxy)phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one;hydrochloride.
| Compound Name | (E)-1-[4-(3-morpholin-4-ylpropoxy)phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one;hydrochloride |
|---|---|
| PubChem CID | 71812184 |
| Molecular Formula | C23H25ClF3NO3 |
| Molecular Weight | 455.90 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | (E)-1-[4-(3-morpholin-4-ylpropoxy)phenyl]-3-[2-(trifluoromethyl)phenyl]prop-2-en-1-one;hydrochloride |
| SMILES | Cl.O=C(/C=C/c1ccccc1C(F)(F)F)c1ccc(OCCCN2CCOCC2)cc1 |
| InChI | InChI=1S/C23H24F3NO3.ClH/c24-23(25,26)21-5-2-1-4-18(21)8-11-22(28)19-6-9-20(10-7-19)30-15-3-12-27-13-16-29-17-14-27;/h1-2,4-11H,3,12-17H2;1H/b11-8+; |
| InChIKey | ZYMFBWMCYGLPTP-YGCVIUNWSA-N |
| XLogP | 5.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.90 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|