C17H16F3N3O — CID 136519872
(3-anilinopyrrolidin-1-yl)-[3-(trifluoromethyl)-2-pyridinyl]methanone (PubChem CID 136519872) has the molecular formula C17H16F3N3O and a molecular weight of 335.33 g/mol. Its IUPAC name is (3-anilinopyrrolidin-1-yl)-[3-(trifluoromethyl)-2-pyridinyl]methanone.
| Compound Name | (3-anilinopyrrolidin-1-yl)-[3-(trifluoromethyl)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 136519872 |
| Molecular Formula | C17H16F3N3O |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | (3-anilinopyrrolidin-1-yl)-[3-(trifluoromethyl)-2-pyridinyl]methanone |
| SMILES | O=C(c1ncccc1C(F)(F)F)N1CCC(Nc2ccccc2)C1 |
| InChI | InChI=1S/C17H16F3N3O/c18-17(19,20)14-7-4-9-21-15(14)16(24)23-10-8-13(11-23)22-12-5-2-1-3-6-12/h1-7,9,13,22H,8,10-11H2 |
| InChIKey | PGEXURFFTNILHS-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |