C17H21F3N2O3 — CID 91648435
tert-butyl 1-[3-(trifluoromethyl)pyridine-2-carbonyl]piperidine-3-carboxylate (PubChem CID 91648435) has the molecular formula C17H21F3N2O3 and a molecular weight of 358.36 g/mol. Its IUPAC name is tert-butyl 1-[3-(trifluoromethyl)pyridine-2-carbonyl]piperidine-3-carboxylate.
| Compound Name | tert-butyl 1-[3-(trifluoromethyl)pyridine-2-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 91648435 |
| Molecular Formula | C17H21F3N2O3 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | tert-butyl 1-[3-(trifluoromethyl)pyridine-2-carbonyl]piperidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1CCCN(C(=O)c2ncccc2C(F)(F)F)C1 |
| InChI | InChI=1S/C17H21F3N2O3/c1-16(2,3)25-15(24)11-6-5-9-22(10-11)14(23)13-12(17(18,19)20)7-4-8-21-13/h4,7-8,11H,5-6,9-10H2,1-3H3 |
| InChIKey | GNJKGSQPXJMUOF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |