C16H22N2O3S — CID 99641243
tert-butyl (3R)-1-(2-sulfanylidene-1H-pyridine-3-carbonyl)piperidine-3-carboxylate (PubChem CID 99641243) has the molecular formula C16H22N2O3S and a molecular weight of 322.43 g/mol. Its IUPAC name is tert-butyl (3R)-1-(2-sulfanylidene-1H-pyridine-3-carbonyl)piperidine-3-carboxylate.
| Compound Name | tert-butyl (3R)-1-(2-sulfanylidene-1H-pyridine-3-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 99641243 |
| Molecular Formula | C16H22N2O3S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | tert-butyl (3R)-1-(2-sulfanylidene-1H-pyridine-3-carbonyl)piperidine-3-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@H]1CCCN(C(=O)c2ccc[nH]c2=S)C1 |
| InChI | InChI=1S/C16H22N2O3S/c1-16(2,3)21-15(20)11-6-5-9-18(10-11)14(19)12-7-4-8-17-13(12)22/h4,7-8,11H,5-6,9-10H2,1-3H3,(H,17,22)/t11-/m1/s1 |
| InChIKey | WBZYWNPBYMHVJP-LLVKDONJSA-N |
| XLogP | 2.94 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|