C13H11F3N4O3 — CID 127729779
7-[3-(trifluoromethyl)pyridine-2-carbonyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 127729779) has the molecular formula C13H11F3N4O3 and a molecular weight of 328.25 g/mol. Its IUPAC name is 7-[3-(trifluoromethyl)pyridine-2-carbonyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 7-[3-(trifluoromethyl)pyridine-2-carbonyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 127729779 |
| Molecular Formula | C13H11F3N4O3 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 7-[3-(trifluoromethyl)pyridine-2-carbonyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | O=C1NC(=O)N2CCN(C(=O)c3ncccc3C(F)(F)F)CC12 |
| InChI | InChI=1S/C13H11F3N4O3/c14-13(15,16)7-2-1-3-17-9(7)11(22)19-4-5-20-8(6-19)10(21)18-12(20)23/h1-3,8H,4-6H2,(H,18,21,23) |
| InChIKey | CVCZEHQBQAOWJX-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|