C21H20F3N5O3 — CID 91170995
N,6-dimethyl-9-oxo-12-[2-(trifluoromethyl)benzoyl]-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-5-carboxamide (PubChem CID 91170995) has the molecular formula C21H20F3N5O3 and a molecular weight of 447.42 g/mol. Its IUPAC name is N,6-dimethyl-9-oxo-12-[2-(trifluoromethyl)benzoyl]-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-5-carboxamide.
| Compound Name | N,6-dimethyl-9-oxo-12-[2-(trifluoromethyl)benzoyl]-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-5-carboxamide |
|---|---|
| PubChem CID | 91170995 |
| Molecular Formula | C21H20F3N5O3 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | N,6-dimethyl-9-oxo-12-[2-(trifluoromethyl)benzoyl]-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-5-carboxamide |
| SMILES | CNC(=O)c1cnc2c(c1C)NC(=O)C1CN(C(=O)c3ccccc3C(F)(F)F)CCN21 |
| InChI | InChI=1S/C21H20F3N5O3/c1-11-13(18(30)25-2)9-26-17-16(11)27-19(31)15-10-28(7-8-29(15)17)20(32)12-5-3-4-6-14(12)21(22,23)24/h3-6,9,15H,7-8,10H2,1-2H3,(H,25,30)(H,27,31) |
| InChIKey | YCOVFKLLKSDGJW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |