C24H24F3N3O2 — CID 59766766
[4-[5-[2-(1-hydroxycyclopentyl)ethynyl]-2-pyridinyl]piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 59766766) has the molecular formula C24H24F3N3O2 and a molecular weight of 443.47 g/mol. Its IUPAC name is [4-[5-[2-(1-hydroxycyclopentyl)ethynyl]-2-pyridinyl]piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-[5-[2-(1-hydroxycyclopentyl)ethynyl]-2-pyridinyl]piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 59766766 |
| Molecular Formula | C24H24F3N3O2 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | [4-[5-[2-(1-hydroxycyclopentyl)ethynyl]-2-pyridinyl]piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1C(F)(F)F)N1CCN(c2ccc(C#CC3(O)CCCC3)cn2)CC1 |
| InChI | InChI=1S/C24H24F3N3O2/c25-24(26,27)20-6-2-1-5-19(20)22(31)30-15-13-29(14-16-30)21-8-7-18(17-28-21)9-12-23(32)10-3-4-11-23/h1-2,5-8,17,32H,3-4,10-11,13-16H2 |
| InChIKey | UUUJBXFSLREGNU-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|