C28H22F3N5O — CID 59766793
[4-[5-[2-(4-pyrrol-1-ylphenyl)ethynyl]pyrimidin-2-yl]piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone (PubChem CID 59766793) has the molecular formula C28H22F3N5O and a molecular weight of 501.51 g/mol. Its IUPAC name is [4-[5-[2-(4-pyrrol-1-ylphenyl)ethynyl]pyrimidin-2-yl]piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-[5-[2-(4-pyrrol-1-ylphenyl)ethynyl]pyrimidin-2-yl]piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 59766793 |
| Molecular Formula | C28H22F3N5O |
| Molecular Weight | 501.51 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | [4-[5-[2-(4-pyrrol-1-ylphenyl)ethynyl]pyrimidin-2-yl]piperazin-1-yl]-[2-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1C(F)(F)F)N1CCN(c2ncc(C#Cc3ccc(-n4cccc4)cc3)cn2)CC1 |
| InChI | InChI=1S/C28H22F3N5O/c29-28(30,31)25-6-2-1-5-24(25)26(37)35-15-17-36(18-16-35)27-32-19-22(20-33-27)8-7-21-9-11-23(12-10-21)34-13-3-4-14-34/h1-6,9-14,19-20H,15-18H2 |
| InChIKey | ZEZJFFZESITOHK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|