C11H15F3N2O4 — CID 120529230
3-methyl-1-[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]pyrrolidine-3-carboxylic acid (PubChem CID 120529230) has the molecular formula C11H15F3N2O4 and a molecular weight of 296.25 g/mol. Its IUPAC name is 3-methyl-1-[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 120529230 |
| Molecular Formula | C11H15F3N2O4 |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-methyl-1-[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)CC(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H15F3N2O4/c1-10(9(19)20)2-3-16(6-10)8(18)4-7(17)15-5-11(12,13)14/h2-6H2,1H3,(H,15,17)(H,19,20) |
| InChIKey | NRIMKMKMDYNDEW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|