C11H17F3N2O3S — CID 122008634
3-methyl-1-[2-(2,2,2-trifluoroethylsulfanyl)ethylcarbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 122008634) has the molecular formula C11H17F3N2O3S and a molecular weight of 314.33 g/mol. Its IUPAC name is 3-methyl-1-[2-(2,2,2-trifluoroethylsulfanyl)ethylcarbamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-methyl-1-[2-(2,2,2-trifluoroethylsulfanyl)ethylcarbamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122008634 |
| Molecular Formula | C11H17F3N2O3S |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 3-methyl-1-[2-(2,2,2-trifluoroethylsulfanyl)ethylcarbamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)NCCSCC(F)(F)F)C1 |
| InChI | InChI=1S/C11H17F3N2O3S/c1-10(8(17)18)2-4-16(6-10)9(19)15-3-5-20-7-11(12,13)14/h2-7H2,1H3,(H,15,19)(H,17,18) |
| InChIKey | FUHNYZWSBAHENE-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|