C17H24ClNO3 — CID 120532467
3-[[3-(3-chlorophenyl)-2-methylpropanoyl]amino]-3-ethylpentanoic acid (PubChem CID 120532467) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is 3-[[3-(3-chlorophenyl)-2-methylpropanoyl]amino]-3-ethylpentanoic acid.
| Compound Name | 3-[[3-(3-chlorophenyl)-2-methylpropanoyl]amino]-3-ethylpentanoic acid |
|---|---|
| PubChem CID | 120532467 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 3-[[3-(3-chlorophenyl)-2-methylpropanoyl]amino]-3-ethylpentanoic acid |
| SMILES | CCC(CC)(CC(=O)O)NC(=O)C(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H24ClNO3/c1-4-17(5-2,11-15(20)21)19-16(22)12(3)9-13-7-6-8-14(18)10-13/h6-8,10,12H,4-5,9,11H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | RJGHYRBFXJBGAN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |