C18H22N2O3 — CID 120534876
4-[(2-propan-2-ylquinoline-4-carbonyl)amino]pentanoic acid (PubChem CID 120534876) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 4-[(2-propan-2-ylquinoline-4-carbonyl)amino]pentanoic acid.
| Compound Name | 4-[(2-propan-2-ylquinoline-4-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 120534876 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 4-[(2-propan-2-ylquinoline-4-carbonyl)amino]pentanoic acid |
| SMILES | CC(CCC(=O)O)NC(=O)c1cc(C(C)C)nc2ccccc12 |
| InChI | InChI=1S/C18H22N2O3/c1-11(2)16-10-14(13-6-4-5-7-15(13)20-16)18(23)19-12(3)8-9-17(21)22/h4-7,10-12H,8-9H2,1-3H3,(H,19,23)(H,21,22) |
| InChIKey | HOXQINZYPPNASW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |