C21H20ClN3O2 — CID 26996817
N'-[2-(4-chlorophenyl)acetyl]-2-propan-2-ylquinoline-4-carbohydrazide (PubChem CID 26996817) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)acetyl]-2-propan-2-ylquinoline-4-carbohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)acetyl]-2-propan-2-ylquinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 26996817 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N'-[2-(4-chlorophenyl)acetyl]-2-propan-2-ylquinoline-4-carbohydrazide |
| SMILES | CC(C)c1cc(C(=O)NNC(=O)Cc2ccc(Cl)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C21H20ClN3O2/c1-13(2)19-12-17(16-5-3-4-6-18(16)23-19)21(27)25-24-20(26)11-14-7-9-15(22)10-8-14/h3-10,12-13H,11H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | DWLZAFIHPCSNDQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|