C16H25N3O3 — CID 120535565
8-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carbonylamino)octanoic acid (PubChem CID 120535565) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is 8-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carbonylamino)octanoic acid.
| Compound Name | 8-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carbonylamino)octanoic acid |
|---|---|
| PubChem CID | 120535565 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 8-(4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine-3-carbonylamino)octanoic acid |
| SMILES | O=C(O)CCCCCCCNC(=O)c1cnn2c1CCCC2 |
| InChI | InChI=1S/C16H25N3O3/c20-15(21)9-4-2-1-3-6-10-17-16(22)13-12-18-19-11-7-5-8-14(13)19/h12H,1-11H2,(H,17,22)(H,20,21) |
| InChIKey | YVPXJKVIJDYDNN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|