About (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid
(6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid (PubChem CID 120536045) has the molecular formula C16H27NO4
and a molecular weight of 297.39 g/mol. Its IUPAC name is (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid.
Molecular Properties
| Compound Name | (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid |
| PubChem CID | 120536045 |
| Molecular Formula | C16H27NO4 |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)CC2CCC(C)(C)CC2)CC(C(=O)O)O1 |
| InChI | InChI=1S/C16H27NO4/c1-11-9-17(10-13(21-11)15(19)20)14(18)8-12-4-6-16(2,3)7-5-12/h11-13H,4-10H2,1-3H3,(H,19,20)/t11-,13?/m1/s1 |
| InChIKey | NBQRHKHSJKUXKZ-JTDNENJMSA-N |
| XLogP | 2.29 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid?
The IUPAC name of (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid (CID 120536045) is (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid.
What is the SMILES notation for (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid?
The canonical SMILES for (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid is C[C@@H]1CN(C(=O)CC2CCC(C)(C)CC2)CC(C(=O)O)O1.
What is the InChIKey of (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid?
The InChIKey is NBQRHKHSJKUXKZ-JTDNENJMSA-N. The full InChI is InChI=1S/C16H27NO4/c1-11-9-17(10-13(21-11)15(19)20)14(18)8-12-4-6-16(2,3)7-5-12/h11-13H,4-10H2,1-3H3,(H,19,20)/t11-,13?/m1/s1.
What are the key properties of (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid?
(6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid has a molecular weight of 297.39 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-4-[2-(4,4-dimethylcyclohexyl)acetyl]-6-methylmorpholine-2-carboxylic acid is sourced from PubChem (CID 120536045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).