C11H15F3N2O5 — CID 120536137
(6R)-6-methyl-4-[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]morpholine-2-carboxylic acid (PubChem CID 120536137) has the molecular formula C11H15F3N2O5 and a molecular weight of 312.24 g/mol. Its IUPAC name is (6R)-6-methyl-4-[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]morpholine-2-carboxylic acid.
| Compound Name | (6R)-6-methyl-4-[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]morpholine-2-carboxylic acid |
|---|---|
| PubChem CID | 120536137 |
| Molecular Formula | C11H15F3N2O5 |
| Molecular Weight | 312.24 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | (6R)-6-methyl-4-[3-oxo-3-(2,2,2-trifluoroethylamino)propanoyl]morpholine-2-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)CC(=O)NCC(F)(F)F)CC(C(=O)O)O1 |
| InChI | InChI=1S/C11H15F3N2O5/c1-6-3-16(4-7(21-6)10(19)20)9(18)2-8(17)15-5-11(12,13)14/h6-7H,2-5H2,1H3,(H,15,17)(H,19,20)/t6-,7?/m1/s1 |
| InChIKey | SCUOSVAOEJFNKC-ULUSZKPHSA-N |
| XLogP | -0.24 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.24 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|