C14H16N4O3 — CID 120536966
3-methyl-4-[(1-phenyl-1,2,4-triazole-3-carbonyl)amino]butanoic acid (PubChem CID 120536966) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is 3-methyl-4-[(1-phenyl-1,2,4-triazole-3-carbonyl)amino]butanoic acid.
| Compound Name | 3-methyl-4-[(1-phenyl-1,2,4-triazole-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 120536966 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | 3-methyl-4-[(1-phenyl-1,2,4-triazole-3-carbonyl)amino]butanoic acid |
| SMILES | CC(CNC(=O)c1ncn(-c2ccccc2)n1)CC(=O)O |
| InChI | InChI=1S/C14H16N4O3/c1-10(7-12(19)20)8-15-14(21)13-16-9-18(17-13)11-5-3-2-4-6-11/h2-6,9-10H,7-8H2,1H3,(H,15,21)(H,19,20) |
| InChIKey | QJAPDWXTQKMZNG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |