C17H19N5O5 — CID 120539960
1-[methyl-[1-(3-nitrophenyl)triazole-4-carbonyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 120539960) has the molecular formula C17H19N5O5 and a molecular weight of 373.37 g/mol. Its IUPAC name is 1-[methyl-[1-(3-nitrophenyl)triazole-4-carbonyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[methyl-[1-(3-nitrophenyl)triazole-4-carbonyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120539960 |
| Molecular Formula | C17H19N5O5 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1-[methyl-[1-(3-nitrophenyl)triazole-4-carbonyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | CN(C(=O)c1cn(-c2cccc([N+](=O)[O-])c2)nn1)C1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C17H19N5O5/c1-20(17(16(24)25)8-3-2-4-9-17)15(23)14-11-21(19-18-14)12-6-5-7-13(10-12)22(26)27/h5-7,10-11H,2-4,8-9H2,1H3,(H,24,25) |
| InChIKey | MHGCGLWDHJLMKO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 131.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|