C17H18ClFN2O3 — CID 120543884
1-[[(3-chloro-5-fluoro-1H-indole-2-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid (PubChem CID 120543884) has the molecular formula C17H18ClFN2O3 and a molecular weight of 352.79 g/mol. Its IUPAC name is 1-[[(3-chloro-5-fluoro-1H-indole-2-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[(3-chloro-5-fluoro-1H-indole-2-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120543884 |
| Molecular Formula | C17H18ClFN2O3 |
| Molecular Weight | 352.79 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | 1-[[(3-chloro-5-fluoro-1H-indole-2-carbonyl)amino]methyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(NCC1(C(=O)O)CCCCC1)c1[nH]c2ccc(F)cc2c1Cl |
| InChI | InChI=1S/C17H18ClFN2O3/c18-13-11-8-10(19)4-5-12(11)21-14(13)15(22)20-9-17(16(23)24)6-2-1-3-7-17/h4-5,8,21H,1-3,6-7,9H2,(H,20,22)(H,23,24) |
| InChIKey | HCMMHUFZMWLNID-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |