C21H30N2O4 — CID 120547104
4-[(1-butanoylpiperidine-3-carbonyl)amino]-5-phenylpentanoic acid (PubChem CID 120547104) has the molecular formula C21H30N2O4 and a molecular weight of 374.48 g/mol. Its IUPAC name is 4-[(1-butanoylpiperidine-3-carbonyl)amino]-5-phenylpentanoic acid.
| Compound Name | 4-[(1-butanoylpiperidine-3-carbonyl)amino]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 120547104 |
| Molecular Formula | C21H30N2O4 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 4-[(1-butanoylpiperidine-3-carbonyl)amino]-5-phenylpentanoic acid |
| SMILES | CCCC(=O)N1CCCC(C(=O)NC(CCC(=O)O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C21H30N2O4/c1-2-7-19(24)23-13-6-10-17(15-23)21(27)22-18(11-12-20(25)26)14-16-8-4-3-5-9-16/h3-5,8-9,17-18H,2,6-7,10-15H2,1H3,(H,22,27)(H,25,26) |
| InChIKey | XDSLKLPYXAUZPY-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |