C21H22F3NO3 — CID 120547242
5-phenyl-4-[[4-(3,3,3-trifluoropropyl)benzoyl]amino]pentanoic acid (PubChem CID 120547242) has the molecular formula C21H22F3NO3 and a molecular weight of 393.41 g/mol. Its IUPAC name is 5-phenyl-4-[[4-(3,3,3-trifluoropropyl)benzoyl]amino]pentanoic acid.
| Compound Name | 5-phenyl-4-[[4-(3,3,3-trifluoropropyl)benzoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 120547242 |
| Molecular Formula | C21H22F3NO3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | 5-phenyl-4-[[4-(3,3,3-trifluoropropyl)benzoyl]amino]pentanoic acid |
| SMILES | O=C(O)CCC(Cc1ccccc1)NC(=O)c1ccc(CCC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H22F3NO3/c22-21(23,24)13-12-15-6-8-17(9-7-15)20(28)25-18(10-11-19(26)27)14-16-4-2-1-3-5-16/h1-9,18H,10-14H2,(H,25,28)(H,26,27) |
| InChIKey | NXJMYRUBFGYKDG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |