About 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid
2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid (PubChem CID 120551885) has the molecular formula C19H22N4O4
and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid |
| PubChem CID | 120551885 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid |
| SMILES | Cc1cc(N2CCCC(NC(=O)Cc3ccccc3C(=O)O)C2=O)n(C)n1 |
| InChI | InChI=1S/C19H22N4O4/c1-12-10-17(22(2)21-12)23-9-5-8-15(18(23)25)20-16(24)11-13-6-3-4-7-14(13)19(26)27/h3-4,6-7,10,15H,5,8-9,11H2,1-2H3,(H,20,24)(H,26,27) |
| InChIKey | YZNZNPXDJFFDOM-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid?
The IUPAC name of 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid (CID 120551885) is 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid.
What is the SMILES notation for 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid?
The canonical SMILES for 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid is Cc1cc(N2CCCC(NC(=O)Cc3ccccc3C(=O)O)C2=O)n(C)n1.
What is the InChIKey of 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid?
The InChIKey is YZNZNPXDJFFDOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N4O4/c1-12-10-17(22(2)21-12)23-9-5-8-15(18(23)25)20-16(24)11-13-6-3-4-7-14(13)19(26)27/h3-4,6-7,10,15H,5,8-9,11H2,1-2H3,(H,20,24)(H,26,27).
What are the key properties of 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid?
2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid has a molecular weight of 370.41 g/mol, XLogP of 1.28, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[[1-(2,5-dimethylpyrazol-3-yl)-2-oxopiperidin-3-yl]amino]-2-oxoethyl]benzoic acid is sourced from PubChem (CID 120551885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).