C19H27NO4S — CID 120552001
2-[2-[[1-(2-ethoxyethyl)cyclobutyl]methylcarbamoyl]phenyl]sulfanylpropanoic acid (PubChem CID 120552001) has the molecular formula C19H27NO4S and a molecular weight of 365.50 g/mol. Its IUPAC name is 2-[2-[[1-(2-ethoxyethyl)cyclobutyl]methylcarbamoyl]phenyl]sulfanylpropanoic acid.
| Compound Name | 2-[2-[[1-(2-ethoxyethyl)cyclobutyl]methylcarbamoyl]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 120552001 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-[2-[[1-(2-ethoxyethyl)cyclobutyl]methylcarbamoyl]phenyl]sulfanylpropanoic acid |
| SMILES | CCOCCC1(CNC(=O)c2ccccc2SC(C)C(=O)O)CCC1 |
| InChI | InChI=1S/C19H27NO4S/c1-3-24-12-11-19(9-6-10-19)13-20-17(21)15-7-4-5-8-16(15)25-14(2)18(22)23/h4-5,7-8,14H,3,6,9-13H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | VOHQKGIXUSIUCH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|