About 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide
2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide (PubChem CID 120555110) has the molecular formula C22H26N4O2
and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide.
Molecular Properties
| Compound Name | 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide |
| PubChem CID | 120555110 |
| Molecular Formula | C22H26N4O2 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide |
| SMILES | Cc1cccn2cc(COc3ccccc3C(=O)NC3CCNCC3C)nc12 |
| InChI | InChI=1S/C22H26N4O2/c1-15-6-5-11-26-13-17(24-21(15)26)14-28-20-8-4-3-7-18(20)22(27)25-19-9-10-23-12-16(19)2/h3-8,11,13,16,19,23H,9-10,12,14H2,1-2H3,(H,25,27) |
| InChIKey | AIGOHVAZMKVNBQ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide?
The IUPAC name of 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide (CID 120555110) is 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide.
What is the SMILES notation for 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide?
The canonical SMILES for 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide is Cc1cccn2cc(COc3ccccc3C(=O)NC3CCNCC3C)nc12.
What is the InChIKey of 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide?
The InChIKey is AIGOHVAZMKVNBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26N4O2/c1-15-6-5-11-26-13-17(24-21(15)26)14-28-20-8-4-3-7-18(20)22(27)25-19-9-10-23-12-16(19)2/h3-8,11,13,16,19,23H,9-10,12,14H2,1-2H3,(H,25,27).
What are the key properties of 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide?
2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide has a molecular weight of 378.48 g/mol, XLogP of 2.95, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(8-methylimidazo[1,2-a]pyridin-2-yl)methoxy]-N-(3-methylpiperidin-4-yl)benzamide is sourced from PubChem (CID 120555110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).