About CID 12055554
CID 12055554 (PubChem CID 12055554) has the molecular formula C9H13NSi
and a molecular weight of 163.30 g/mol.
Molecular Properties
| Compound Name | CID 12055554 |
| PubChem CID | 12055554 |
| Molecular Formula | C9H13NSi |
| Molecular Weight | 163.30 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | — |
| SMILES | CC(C)N[Si]c1ccccc1 |
| InChI | InChI=1S/C9H13NSi/c1-8(2)10-11-9-6-4-3-5-7-9/h3-8,10H,1-2H3 |
| InChIKey | UNYJZMLLNYJNFC-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.30 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 12055554 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12055554?
The IUPAC name of CID 12055554 (CID 12055554) is not available.
What is the SMILES notation for CID 12055554?
The canonical SMILES for CID 12055554 is CC(C)N[Si]c1ccccc1.
What is the InChIKey of CID 12055554?
The InChIKey is UNYJZMLLNYJNFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NSi/c1-8(2)10-11-9-6-4-3-5-7-9/h3-8,10H,1-2H3.
What are the key properties of CID 12055554?
CID 12055554 has a molecular weight of 163.30 g/mol, XLogP of 0.93, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12055554 is sourced from PubChem (CID 12055554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).