About Diphenylsilicon
Diphenylsilicon (PubChem CID 6327659) has the molecular formula C12H10Si
and a molecular weight of 182.30 g/mol.
Molecular Properties
| Compound Name | Diphenylsilicon |
| PubChem CID | 6327659 |
| Molecular Formula | C12H10Si |
| Molecular Weight | 182.30 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | — |
| SMILES | c1ccc([Si]c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10Si/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H |
| InChIKey | BPYFPNZHLXDIGA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.30 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Diphenylsilicon with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Diphenylsilicon?
The IUPAC name of Diphenylsilicon (CID 6327659) is not available.
What is the SMILES notation for Diphenylsilicon?
The canonical SMILES for Diphenylsilicon is c1ccc([Si]c2ccccc2)cc1.
What is the InChIKey of Diphenylsilicon?
The InChIKey is BPYFPNZHLXDIGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Si/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h1-10H.
What are the key properties of Diphenylsilicon?
Diphenylsilicon has a molecular weight of 182.30 g/mol, XLogP of 1.34, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Diphenylsilicon is sourced from PubChem (CID 6327659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).